C20H28ClN5O2 — CID 111982199
N'-[2-(2-chlorophenyl)-2-hydroxyethyl]-N-ethyl-4-[(5-methyl-1,2-oxazol-3-yl)methyl]piperazine-1-carboximidamide (PubChem CID 111982199) has the molecular formula C20H28ClN5O2 and a molecular weight of 405.93 g/mol. Its IUPAC name is N'-[2-(2-chlorophenyl)-2-hydroxyethyl]-N-ethyl-4-[(5-methyl-1,2-oxazol-3-yl)methyl]piperazine-1-carboximidamide.
| Compound Name | N'-[2-(2-chlorophenyl)-2-hydroxyethyl]-N-ethyl-4-[(5-methyl-1,2-oxazol-3-yl)methyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111982199 |
| Molecular Formula | C20H28ClN5O2 |
| Molecular Weight | 405.93 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | N'-[2-(2-chlorophenyl)-2-hydroxyethyl]-N-ethyl-4-[(5-methyl-1,2-oxazol-3-yl)methyl]piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CC(O)c1ccccc1Cl)N1CCN(Cc2cc(C)on2)CC1 |
| InChI | InChI=1S/C20H28ClN5O2/c1-3-22-20(23-13-19(27)17-6-4-5-7-18(17)21)26-10-8-25(9-11-26)14-16-12-15(2)28-24-16/h4-7,12,19,27H,3,8-11,13-14H2,1-2H3,(H,22,23) |
| InChIKey | VSIMPIKYGCVXRZ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 77.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.93 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|