C19H31ClN4O — CID 111990371
N'-[2-(2-chlorophenyl)-2-hydroxyethyl]-3-(diethylamino)-N-ethylpyrrolidine-1-carboximidamide (PubChem CID 111990371) has the molecular formula C19H31ClN4O and a molecular weight of 366.94 g/mol. Its IUPAC name is N'-[2-(2-chlorophenyl)-2-hydroxyethyl]-3-(diethylamino)-N-ethylpyrrolidine-1-carboximidamide.
| Compound Name | N'-[2-(2-chlorophenyl)-2-hydroxyethyl]-3-(diethylamino)-N-ethylpyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111990371 |
| Molecular Formula | C19H31ClN4O |
| Molecular Weight | 366.94 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | N'-[2-(2-chlorophenyl)-2-hydroxyethyl]-3-(diethylamino)-N-ethylpyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\CC(O)c1ccccc1Cl)N1CCC(N(CC)CC)C1 |
| InChI | InChI=1S/C19H31ClN4O/c1-4-21-19(24-12-11-15(14-24)23(5-2)6-3)22-13-18(25)16-9-7-8-10-17(16)20/h7-10,15,18,25H,4-6,11-14H2,1-3H3,(H,21,22) |
| InChIKey | VWMLSAGHDBUJNS-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.94 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|