C21H35ClIN5O — CID 110963414
4-acetyl-N'-[2-(2-chlorophenyl)-2-(diethylamino)ethyl]-N-ethylpiperazine-1-carboximidamide;hydroiodide (PubChem CID 110963414) has the molecular formula C21H35ClIN5O and a molecular weight of 535.90 g/mol. Its IUPAC name is 4-acetyl-N'-[2-(2-chlorophenyl)-2-(diethylamino)ethyl]-N-ethylpiperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-acetyl-N'-[2-(2-chlorophenyl)-2-(diethylamino)ethyl]-N-ethylpiperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 110963414 |
| Molecular Formula | C21H35ClIN5O |
| Molecular Weight | 535.90 g/mol |
| Exact Mass | 535.16 |
| IUPAC Name | 4-acetyl-N'-[2-(2-chlorophenyl)-2-(diethylamino)ethyl]-N-ethylpiperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CC(c1ccccc1Cl)N(CC)CC)N1CCN(C(C)=O)CC1.I |
| InChI | InChI=1S/C21H34ClN5O.HI/c1-5-23-21(27-14-12-26(13-15-27)17(4)28)24-16-20(25(6-2)7-3)18-10-8-9-11-19(18)22;/h8-11,20H,5-7,12-16H2,1-4H3,(H,23,24);1H |
| InChIKey | VFNZUIAAMQJPAL-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 51.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.90 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|