C23H31FIN3O3 — CID 109425799
N-ethyl-N'-[3-(4-fluorophenoxy)-2-hydroxypropyl]-4-phenoxypiperidine-1-carboximidamide;hydroiodide (PubChem CID 109425799) has the molecular formula C23H31FIN3O3 and a molecular weight of 543.42 g/mol. Its IUPAC name is N-ethyl-N'-[3-(4-fluorophenoxy)-2-hydroxypropyl]-4-phenoxypiperidine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-N'-[3-(4-fluorophenoxy)-2-hydroxypropyl]-4-phenoxypiperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109425799 |
| Molecular Formula | C23H31FIN3O3 |
| Molecular Weight | 543.42 g/mol |
| Exact Mass | 543.14 |
| IUPAC Name | N-ethyl-N'-[3-(4-fluorophenoxy)-2-hydroxypropyl]-4-phenoxypiperidine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CC(O)COc1ccc(F)cc1)N1CCC(Oc2ccccc2)CC1.I |
| InChI | InChI=1S/C23H30FN3O3.HI/c1-2-25-23(26-16-19(28)17-29-20-10-8-18(24)9-11-20)27-14-12-22(13-15-27)30-21-6-4-3-5-7-21;/h3-11,19,22,28H,2,12-17H2,1H3,(H,25,26);1H |
| InChIKey | WFCKUNMWZWPFGN-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.42 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|