C22H29FIN3O2 — CID 111993110
N-ethyl-N'-[3-(4-fluorophenoxy)-2-hydroxypropyl]-3-phenylpyrrolidine-1-carboximidamide;hydroiodide (PubChem CID 111993110) has the molecular formula C22H29FIN3O2 and a molecular weight of 513.40 g/mol. Its IUPAC name is N-ethyl-N'-[3-(4-fluorophenoxy)-2-hydroxypropyl]-3-phenylpyrrolidine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-N'-[3-(4-fluorophenoxy)-2-hydroxypropyl]-3-phenylpyrrolidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111993110 |
| Molecular Formula | C22H29FIN3O2 |
| Molecular Weight | 513.40 g/mol |
| Exact Mass | 513.13 |
| IUPAC Name | N-ethyl-N'-[3-(4-fluorophenoxy)-2-hydroxypropyl]-3-phenylpyrrolidine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CC(O)COc1ccc(F)cc1)N1CCC(c2ccccc2)C1.I |
| InChI | InChI=1S/C22H28FN3O2.HI/c1-2-24-22(26-13-12-18(15-26)17-6-4-3-5-7-17)25-14-20(27)16-28-21-10-8-19(23)9-11-21;/h3-11,18,20,27H,2,12-16H2,1H3,(H,24,25);1H |
| InChIKey | DJOSYAQPSROLGR-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 57.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.40 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|