C21H27FN4O4 — CID 111167529
N-ethyl-N'-[3-(4-fluorophenoxy)-2-hydroxypropyl]-4-(furan-2-carbonyl)piperazine-1-carboximidamide (PubChem CID 111167529) has the molecular formula C21H27FN4O4 and a molecular weight of 418.47 g/mol. Its IUPAC name is N-ethyl-N'-[3-(4-fluorophenoxy)-2-hydroxypropyl]-4-(furan-2-carbonyl)piperazine-1-carboximidamide.
| Compound Name | N-ethyl-N'-[3-(4-fluorophenoxy)-2-hydroxypropyl]-4-(furan-2-carbonyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111167529 |
| Molecular Formula | C21H27FN4O4 |
| Molecular Weight | 418.47 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | N-ethyl-N'-[3-(4-fluorophenoxy)-2-hydroxypropyl]-4-(furan-2-carbonyl)piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CC(O)COc1ccc(F)cc1)N1CCN(C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C21H27FN4O4/c1-2-23-21(24-14-17(27)15-30-18-7-5-16(22)6-8-18)26-11-9-25(10-12-26)20(28)19-4-3-13-29-19/h3-8,13,17,27H,2,9-12,14-15H2,1H3,(H,23,24) |
| InChIKey | IPVCHVDGQPYTGK-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.47 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|