C20H25ClN4O3 — CID 111168221
N'-[2-(4-chlorophenyl)-2-hydroxyethyl]-N-ethyl-4-(furan-2-carbonyl)piperazine-1-carboximidamide (PubChem CID 111168221) has the molecular formula C20H25ClN4O3 and a molecular weight of 404.90 g/mol. Its IUPAC name is N'-[2-(4-chlorophenyl)-2-hydroxyethyl]-N-ethyl-4-(furan-2-carbonyl)piperazine-1-carboximidamide.
| Compound Name | N'-[2-(4-chlorophenyl)-2-hydroxyethyl]-N-ethyl-4-(furan-2-carbonyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111168221 |
| Molecular Formula | C20H25ClN4O3 |
| Molecular Weight | 404.90 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | N'-[2-(4-chlorophenyl)-2-hydroxyethyl]-N-ethyl-4-(furan-2-carbonyl)piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CC(O)c1ccc(Cl)cc1)N1CCN(C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C20H25ClN4O3/c1-2-22-20(23-14-17(26)15-5-7-16(21)8-6-15)25-11-9-24(10-12-25)19(27)18-4-3-13-28-18/h3-8,13,17,26H,2,9-12,14H2,1H3,(H,22,23) |
| InChIKey | TVPIIDNVCUAQLO-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 81.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.90 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|