C22H31ClIN5O2 — CID 111979868
N'-[2-(4-chlorophenyl)-2-(dimethylamino)ethyl]-N-ethyl-4-(furan-2-carbonyl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 111979868) has the molecular formula C22H31ClIN5O2 and a molecular weight of 559.88 g/mol. Its IUPAC name is N'-[2-(4-chlorophenyl)-2-(dimethylamino)ethyl]-N-ethyl-4-(furan-2-carbonyl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[2-(4-chlorophenyl)-2-(dimethylamino)ethyl]-N-ethyl-4-(furan-2-carbonyl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111979868 |
| Molecular Formula | C22H31ClIN5O2 |
| Molecular Weight | 559.88 g/mol |
| Exact Mass | 559.12 |
| IUPAC Name | N'-[2-(4-chlorophenyl)-2-(dimethylamino)ethyl]-N-ethyl-4-(furan-2-carbonyl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CC(c1ccc(Cl)cc1)N(C)C)N1CCN(C(=O)c2ccco2)CC1.I |
| InChI | InChI=1S/C22H30ClN5O2.HI/c1-4-24-22(25-16-19(26(2)3)17-7-9-18(23)10-8-17)28-13-11-27(12-14-28)21(29)20-6-5-15-30-20;/h5-10,15,19H,4,11-14,16H2,1-3H3,(H,24,25);1H |
| InChIKey | BNUOMFMDWVQSHB-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 64.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.88 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|