C20H32N6O2 — CID 111518385
N'-methyl-4-[(5-methyl-1,2-oxazol-3-yl)methyl]-N-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]piperazine-1-carboximidamide (PubChem CID 111518385) has the molecular formula C20H32N6O2 and a molecular weight of 388.52 g/mol. Its IUPAC name is N'-methyl-4-[(5-methyl-1,2-oxazol-3-yl)methyl]-N-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]piperazine-1-carboximidamide.
| Compound Name | N'-methyl-4-[(5-methyl-1,2-oxazol-3-yl)methyl]-N-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111518385 |
| Molecular Formula | C20H32N6O2 |
| Molecular Weight | 388.52 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | N'-methyl-4-[(5-methyl-1,2-oxazol-3-yl)methyl]-N-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]piperazine-1-carboximidamide |
| SMILES | CCC(CC)c1cc(CN/C(=N\C)N2CCN(Cc3cc(C)on3)CC2)on1 |
| InChI | InChI=1S/C20H32N6O2/c1-5-16(6-2)19-12-18(28-24-19)13-22-20(21-4)26-9-7-25(8-10-26)14-17-11-15(3)27-23-17/h11-12,16H,5-10,13-14H2,1-4H3,(H,21,22) |
| InChIKey | LMNZKCITRRPXOG-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 82.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.52 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|