C22H32N4O2 — CID 109481009
N'-methyl-2-(2-methylphenyl)-N-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]morpholine-4-carboximidamide (PubChem CID 109481009) has the molecular formula C22H32N4O2 and a molecular weight of 384.52 g/mol. Its IUPAC name is N'-methyl-2-(2-methylphenyl)-N-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]morpholine-4-carboximidamide.
| Compound Name | N'-methyl-2-(2-methylphenyl)-N-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]morpholine-4-carboximidamide |
|---|---|
| PubChem CID | 109481009 |
| Molecular Formula | C22H32N4O2 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.25 |
| IUPAC Name | N'-methyl-2-(2-methylphenyl)-N-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]morpholine-4-carboximidamide |
| SMILES | CCC(CC)c1cc(CN/C(=N\C)N2CCOC(c3ccccc3C)C2)on1 |
| InChI | InChI=1S/C22H32N4O2/c1-5-17(6-2)20-13-18(28-25-20)14-24-22(23-4)26-11-12-27-21(15-26)19-10-8-7-9-16(19)3/h7-10,13,17,21H,5-6,11-12,14-15H2,1-4H3,(H,23,24) |
| InChIKey | UYWPGSPOQRWGEY-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 62.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|