C19H30N4O2 — CID 109480572
N'-methyl-N-[(4-methylmorpholin-2-yl)methyl]-2-(2-methylphenyl)morpholine-4-carboximidamide (PubChem CID 109480572) has the molecular formula C19H30N4O2 and a molecular weight of 346.47 g/mol. Its IUPAC name is N'-methyl-N-[(4-methylmorpholin-2-yl)methyl]-2-(2-methylphenyl)morpholine-4-carboximidamide.
| Compound Name | N'-methyl-N-[(4-methylmorpholin-2-yl)methyl]-2-(2-methylphenyl)morpholine-4-carboximidamide |
|---|---|
| PubChem CID | 109480572 |
| Molecular Formula | C19H30N4O2 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.24 |
| IUPAC Name | N'-methyl-N-[(4-methylmorpholin-2-yl)methyl]-2-(2-methylphenyl)morpholine-4-carboximidamide |
| SMILES | C/N=C(\NCC1CN(C)CCO1)N1CCOC(c2ccccc2C)C1 |
| InChI | InChI=1S/C19H30N4O2/c1-15-6-4-5-7-17(15)18-14-23(9-11-25-18)19(20-2)21-12-16-13-22(3)8-10-24-16/h4-7,16,18H,8-14H2,1-3H3,(H,20,21) |
| InChIKey | HORWRZFODUUKKX-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|