C21H36IN5O — CID 109481283
N'-methyl-N-[2-(4-methyl-1,4-diazepan-1-yl)ethyl]-2-(2-methylphenyl)morpholine-4-carboximidamide;hydroiodide (PubChem CID 109481283) has the molecular formula C21H36IN5O and a molecular weight of 501.46 g/mol. Its IUPAC name is N'-methyl-N-[2-(4-methyl-1,4-diazepan-1-yl)ethyl]-2-(2-methylphenyl)morpholine-4-carboximidamide;hydroiodide.
| Compound Name | N'-methyl-N-[2-(4-methyl-1,4-diazepan-1-yl)ethyl]-2-(2-methylphenyl)morpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109481283 |
| Molecular Formula | C21H36IN5O |
| Molecular Weight | 501.46 g/mol |
| Exact Mass | 501.20 |
| IUPAC Name | N'-methyl-N-[2-(4-methyl-1,4-diazepan-1-yl)ethyl]-2-(2-methylphenyl)morpholine-4-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCCN1CCCN(C)CC1)N1CCOC(c2ccccc2C)C1.I |
| InChI | InChI=1S/C21H35N5O.HI/c1-18-7-4-5-8-19(18)20-17-26(15-16-27-20)21(22-2)23-9-12-25-11-6-10-24(3)13-14-25;/h4-5,7-8,20H,6,9-17H2,1-3H3,(H,22,23);1H |
| InChIKey | SXYIYSBHJQAOQB-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 43.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.46 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|