C22H38IN5O — CID 109481277
N'-methyl-N-[2-methyl-3-(4-methylpiperazin-1-yl)propyl]-2-(2-methylphenyl)morpholine-4-carboximidamide;hydroiodide (PubChem CID 109481277) has the molecular formula C22H38IN5O and a molecular weight of 515.48 g/mol. Its IUPAC name is N'-methyl-N-[2-methyl-3-(4-methylpiperazin-1-yl)propyl]-2-(2-methylphenyl)morpholine-4-carboximidamide;hydroiodide.
| Compound Name | N'-methyl-N-[2-methyl-3-(4-methylpiperazin-1-yl)propyl]-2-(2-methylphenyl)morpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109481277 |
| Molecular Formula | C22H38IN5O |
| Molecular Weight | 515.48 g/mol |
| Exact Mass | 515.21 |
| IUPAC Name | N'-methyl-N-[2-methyl-3-(4-methylpiperazin-1-yl)propyl]-2-(2-methylphenyl)morpholine-4-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCC(C)CN1CCN(C)CC1)N1CCOC(c2ccccc2C)C1.I |
| InChI | InChI=1S/C22H37N5O.HI/c1-18(16-26-11-9-25(4)10-12-26)15-24-22(23-3)27-13-14-28-21(17-27)20-8-6-5-7-19(20)2;/h5-8,18,21H,9-17H2,1-4H3,(H,23,24);1H |
| InChIKey | MZLHPSLCHMMRSM-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 43.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.48 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|