C22H30N4OS — CID 109480520
N-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)ethyl]-N'-methyl-2-(2-methylphenyl)morpholine-4-carboximidamide (PubChem CID 109480520) has the molecular formula C22H30N4OS and a molecular weight of 398.58 g/mol. Its IUPAC name is N-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)ethyl]-N'-methyl-2-(2-methylphenyl)morpholine-4-carboximidamide.
| Compound Name | N-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)ethyl]-N'-methyl-2-(2-methylphenyl)morpholine-4-carboximidamide |
|---|---|
| PubChem CID | 109480520 |
| Molecular Formula | C22H30N4OS |
| Molecular Weight | 398.58 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | N-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)ethyl]-N'-methyl-2-(2-methylphenyl)morpholine-4-carboximidamide |
| SMILES | C/N=C(\NCCN1CCc2sccc2C1)N1CCOC(c2ccccc2C)C1 |
| InChI | InChI=1S/C22H30N4OS/c1-17-5-3-4-6-19(17)20-16-26(12-13-27-20)22(23-2)24-9-11-25-10-7-21-18(15-25)8-14-28-21/h3-6,8,14,20H,7,9-13,15-16H2,1-2H3,(H,23,24) |
| InChIKey | ZCQJHWYYQNKVQS-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.58 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|