C15H20F3N3O3 — CID 111082529
N'-[2-hydroxy-3-[3-(trifluoromethyl)phenoxy]propyl]morpholine-4-carboximidamide (PubChem CID 111082529) has the molecular formula C15H20F3N3O3 and a molecular weight of 347.34 g/mol. Its IUPAC name is N'-[2-hydroxy-3-[3-(trifluoromethyl)phenoxy]propyl]morpholine-4-carboximidamide.
| Compound Name | N'-[2-hydroxy-3-[3-(trifluoromethyl)phenoxy]propyl]morpholine-4-carboximidamide |
|---|---|
| PubChem CID | 111082529 |
| Molecular Formula | C15H20F3N3O3 |
| Molecular Weight | 347.34 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | N'-[2-hydroxy-3-[3-(trifluoromethyl)phenoxy]propyl]morpholine-4-carboximidamide |
| SMILES | N/C(=N\CC(O)COc1cccc(C(F)(F)F)c1)N1CCOCC1 |
| InChI | InChI=1S/C15H20F3N3O3/c16-15(17,18)11-2-1-3-13(8-11)24-10-12(22)9-20-14(19)21-4-6-23-7-5-21/h1-3,8,12,22H,4-7,9-10H2,(H2,19,20) |
| InChIKey | SHCMSXPEUFRNPU-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.34 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|