C16H22F3N3O2 — CID 110987944
1-cyclopropyl-3-ethyl-2-[2-hydroxy-3-[3-(trifluoromethyl)phenoxy]propyl]guanidine (PubChem CID 110987944) has the molecular formula C16H22F3N3O2 and a molecular weight of 345.37 g/mol. Its IUPAC name is 1-cyclopropyl-3-ethyl-2-[2-hydroxy-3-[3-(trifluoromethyl)phenoxy]propyl]guanidine.
| Compound Name | 1-cyclopropyl-3-ethyl-2-[2-hydroxy-3-[3-(trifluoromethyl)phenoxy]propyl]guanidine |
|---|---|
| PubChem CID | 110987944 |
| Molecular Formula | C16H22F3N3O2 |
| Molecular Weight | 345.37 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | 1-cyclopropyl-3-ethyl-2-[2-hydroxy-3-[3-(trifluoromethyl)phenoxy]propyl]guanidine |
| SMILES | CCN/C(=N\CC(O)COc1cccc(C(F)(F)F)c1)NC1CC1 |
| InChI | InChI=1S/C16H22F3N3O2/c1-2-20-15(22-12-6-7-12)21-9-13(23)10-24-14-5-3-4-11(8-14)16(17,18)19/h3-5,8,12-13,23H,2,6-7,9-10H2,1H3,(H2,20,21,22) |
| InChIKey | QUNMXBKGAAOGCL-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.37 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|