C20H29F3N4 — CID 111815130
2-(cyclobutylmethyl)-1-[[1-methyl-2-[4-(trifluoromethyl)phenyl]piperidin-3-yl]methyl]guanidine (PubChem CID 111815130) has the molecular formula C20H29F3N4 and a molecular weight of 382.47 g/mol. Its IUPAC name is 2-(cyclobutylmethyl)-1-[[1-methyl-2-[4-(trifluoromethyl)phenyl]piperidin-3-yl]methyl]guanidine.
| Compound Name | 2-(cyclobutylmethyl)-1-[[1-methyl-2-[4-(trifluoromethyl)phenyl]piperidin-3-yl]methyl]guanidine |
|---|---|
| PubChem CID | 111815130 |
| Molecular Formula | C20H29F3N4 |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 382.23 |
| IUPAC Name | 2-(cyclobutylmethyl)-1-[[1-methyl-2-[4-(trifluoromethyl)phenyl]piperidin-3-yl]methyl]guanidine |
| SMILES | CN1CCCC(CN/C(N)=N/CC2CCC2)C1c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H29F3N4/c1-27-11-3-6-16(13-26-19(24)25-12-14-4-2-5-14)18(27)15-7-9-17(10-8-15)20(21,22)23/h7-10,14,16,18H,2-6,11-13H2,1H3,(H3,24,25,26) |
| InChIKey | YCEURCSWMFIORJ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|