C19H29F3N4 — CID 111791909
2-methyl-1-[[1-methyl-2-[4-(trifluoromethyl)phenyl]piperidin-3-yl]methyl]-3-propan-2-ylguanidine (PubChem CID 111791909) has the molecular formula C19H29F3N4 and a molecular weight of 370.46 g/mol. Its IUPAC name is 2-methyl-1-[[1-methyl-2-[4-(trifluoromethyl)phenyl]piperidin-3-yl]methyl]-3-propan-2-ylguanidine.
| Compound Name | 2-methyl-1-[[1-methyl-2-[4-(trifluoromethyl)phenyl]piperidin-3-yl]methyl]-3-propan-2-ylguanidine |
|---|---|
| PubChem CID | 111791909 |
| Molecular Formula | C19H29F3N4 |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.23 |
| IUPAC Name | 2-methyl-1-[[1-methyl-2-[4-(trifluoromethyl)phenyl]piperidin-3-yl]methyl]-3-propan-2-ylguanidine |
| SMILES | C/N=C(/NCC1CCCN(C)C1c1ccc(C(F)(F)F)cc1)NC(C)C |
| InChI | InChI=1S/C19H29F3N4/c1-13(2)25-18(23-3)24-12-15-6-5-11-26(4)17(15)14-7-9-16(10-8-14)19(20,21)22/h7-10,13,15,17H,5-6,11-12H2,1-4H3,(H2,23,24,25) |
| InChIKey | SNIRKRWKGAPRGC-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|