C20H28F6N4 — CID 109471495
1-ethyl-2-[[1-methyl-2-[4-(trifluoromethyl)phenyl]piperidin-3-yl]methyl]-3-(3,3,3-trifluoropropyl)guanidine (PubChem CID 109471495) has the molecular formula C20H28F6N4 and a molecular weight of 438.46 g/mol. Its IUPAC name is 1-ethyl-2-[[1-methyl-2-[4-(trifluoromethyl)phenyl]piperidin-3-yl]methyl]-3-(3,3,3-trifluoropropyl)guanidine.
| Compound Name | 1-ethyl-2-[[1-methyl-2-[4-(trifluoromethyl)phenyl]piperidin-3-yl]methyl]-3-(3,3,3-trifluoropropyl)guanidine |
|---|---|
| PubChem CID | 109471495 |
| Molecular Formula | C20H28F6N4 |
| Molecular Weight | 438.46 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | 1-ethyl-2-[[1-methyl-2-[4-(trifluoromethyl)phenyl]piperidin-3-yl]methyl]-3-(3,3,3-trifluoropropyl)guanidine |
| SMILES | CCN/C(=N\CC1CCCN(C)C1c1ccc(C(F)(F)F)cc1)NCCC(F)(F)F |
| InChI | InChI=1S/C20H28F6N4/c1-3-27-18(28-11-10-19(21,22)23)29-13-15-5-4-12-30(2)17(15)14-6-8-16(9-7-14)20(24,25)26/h6-9,15,17H,3-5,10-13H2,1-2H3,(H2,27,28,29) |
| InChIKey | QKEFHOLFKYAQMR-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.46 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|