About 3-fluorobenzonitrile;2-(4-hydroxyphenoxy)propanoic acid
3-fluorobenzonitrile;2-(4-hydroxyphenoxy)propanoic acid (PubChem CID 157355506) has the molecular formula C16H14FNO4
and a molecular weight of 303.29 g/mol. Its IUPAC name is 3-fluorobenzonitrile;2-(4-hydroxyphenoxy)propanoic acid.
Molecular Properties
| Compound Name | 3-fluorobenzonitrile;2-(4-hydroxyphenoxy)propanoic acid |
| PubChem CID | 157355506 |
| Molecular Formula | C16H14FNO4 |
| Molecular Weight | 303.29 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | 3-fluorobenzonitrile;2-(4-hydroxyphenoxy)propanoic acid |
| SMILES | CC(Oc1ccc(O)cc1)C(=O)O.N#Cc1cccc(F)c1 |
| InChI | InChI=1S/C9H10O4.C7H4FN/c1-6(9(11)12)13-8-4-2-7(10)3-5-8;8-7-3-1-2-6(4-7)5-9/h2-6,10H,1H3,(H,11,12);1-4H |
| InChIKey | BIALOBYMPSFEHQ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 90.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.29 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-fluorobenzonitrile;2-(4-hydroxyphenoxy)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluorobenzonitrile;2-(4-hydroxyphenoxy)propanoic acid?
The IUPAC name of 3-fluorobenzonitrile;2-(4-hydroxyphenoxy)propanoic acid (CID 157355506) is 3-fluorobenzonitrile;2-(4-hydroxyphenoxy)propanoic acid.
What is the SMILES notation for 3-fluorobenzonitrile;2-(4-hydroxyphenoxy)propanoic acid?
The canonical SMILES for 3-fluorobenzonitrile;2-(4-hydroxyphenoxy)propanoic acid is CC(Oc1ccc(O)cc1)C(=O)O.N#Cc1cccc(F)c1.
What is the InChIKey of 3-fluorobenzonitrile;2-(4-hydroxyphenoxy)propanoic acid?
The InChIKey is BIALOBYMPSFEHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O4.C7H4FN/c1-6(9(11)12)13-8-4-2-7(10)3-5-8;8-7-3-1-2-6(4-7)5-9/h2-6,10H,1H3,(H,11,12);1-4H.
What are the key properties of 3-fluorobenzonitrile;2-(4-hydroxyphenoxy)propanoic acid?
3-fluorobenzonitrile;2-(4-hydroxyphenoxy)propanoic acid has a molecular weight of 303.29 g/mol, XLogP of 2.94, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluorobenzonitrile;2-(4-hydroxyphenoxy)propanoic acid is sourced from PubChem (CID 157355506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).