C17H10Cl2F2O4S — CID 18754519
4-(3,5-dichlorophenyl)-3-(2,5-difluoro-4-methylsulfonylphenyl)-2H-furan-5-one (PubChem CID 18754519) has the molecular formula C17H10Cl2F2O4S and a molecular weight of 419.23 g/mol. Its IUPAC name is 4-(3,5-dichlorophenyl)-3-(2,5-difluoro-4-methylsulfonylphenyl)-2H-furan-5-one.
| Compound Name | 4-(3,5-dichlorophenyl)-3-(2,5-difluoro-4-methylsulfonylphenyl)-2H-furan-5-one |
|---|---|
| PubChem CID | 18754519 |
| Molecular Formula | C17H10Cl2F2O4S |
| Molecular Weight | 419.23 g/mol |
| Exact Mass | 417.96 |
| IUPAC Name | 4-(3,5-dichlorophenyl)-3-(2,5-difluoro-4-methylsulfonylphenyl)-2H-furan-5-one |
| SMILES | CS(=O)(=O)c1cc(F)c(C2=C(c3cc(Cl)cc(Cl)c3)C(=O)OC2)cc1F |
| InChI | InChI=1S/C17H10Cl2F2O4S/c1-26(23,24)15-6-13(20)11(5-14(15)21)12-7-25-17(22)16(12)8-2-9(18)4-10(19)3-8/h2-6H,7H2,1H3 |
| InChIKey | JVVBNWGMQCQZEV-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.23 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|