C18H12F5NO5S — CID 22745443
2,5-difluoro-4-[4-[3-methyl-4-(trifluoromethoxy)phenyl]-5-oxo-2H-furan-3-yl]benzenesulfonamide (PubChem CID 22745443) has the molecular formula C18H12F5NO5S and a molecular weight of 449.35 g/mol. Its IUPAC name is 2,5-difluoro-4-[4-[3-methyl-4-(trifluoromethoxy)phenyl]-5-oxo-2H-furan-3-yl]benzenesulfonamide.
| Compound Name | 2,5-difluoro-4-[4-[3-methyl-4-(trifluoromethoxy)phenyl]-5-oxo-2H-furan-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 22745443 |
| Molecular Formula | C18H12F5NO5S |
| Molecular Weight | 449.35 g/mol |
| Exact Mass | 449.04 |
| IUPAC Name | 2,5-difluoro-4-[4-[3-methyl-4-(trifluoromethoxy)phenyl]-5-oxo-2H-furan-3-yl]benzenesulfonamide |
| SMILES | Cc1cc(C2=C(c3cc(F)c(S(N)(=O)=O)cc3F)COC2=O)ccc1OC(F)(F)F |
| InChI | InChI=1S/C18H12F5NO5S/c1-8-4-9(2-3-14(8)29-18(21,22)23)16-11(7-28-17(16)25)10-5-13(20)15(6-12(10)19)30(24,26)27/h2-6H,7H2,1H3,(H2,24,26,27) |
| InChIKey | VDGCHEYSVRNLOW-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.35 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|