C17H12ClF2NO5S — CID 22746994
4-[4-(4-chloro-3-methoxyphenyl)-5-oxo-2H-furan-3-yl]-2,5-difluorobenzenesulfonamide (PubChem CID 22746994) has the molecular formula C17H12ClF2NO5S and a molecular weight of 415.80 g/mol. Its IUPAC name is 4-[4-(4-chloro-3-methoxyphenyl)-5-oxo-2H-furan-3-yl]-2,5-difluorobenzenesulfonamide.
| Compound Name | 4-[4-(4-chloro-3-methoxyphenyl)-5-oxo-2H-furan-3-yl]-2,5-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 22746994 |
| Molecular Formula | C17H12ClF2NO5S |
| Molecular Weight | 415.80 g/mol |
| Exact Mass | 415.01 |
| IUPAC Name | 4-[4-(4-chloro-3-methoxyphenyl)-5-oxo-2H-furan-3-yl]-2,5-difluorobenzenesulfonamide |
| SMILES | COc1cc(C2=C(c3cc(F)c(S(N)(=O)=O)cc3F)COC2=O)ccc1Cl |
| InChI | InChI=1S/C17H12ClF2NO5S/c1-25-14-4-8(2-3-11(14)18)16-10(7-26-17(16)22)9-5-13(20)15(6-12(9)19)27(21,23)24/h2-6H,7H2,1H3,(H2,21,23,24) |
| InChIKey | XRZZEKJHEUSMML-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.80 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|