C18H13ClF2O4S — CID 18754596
4-(4-chloro-3-methylphenyl)-3-(3,5-difluoro-4-methylsulfonylphenyl)-2H-furan-5-one (PubChem CID 18754596) has the molecular formula C18H13ClF2O4S and a molecular weight of 398.81 g/mol. Its IUPAC name is 4-(4-chloro-3-methylphenyl)-3-(3,5-difluoro-4-methylsulfonylphenyl)-2H-furan-5-one.
| Compound Name | 4-(4-chloro-3-methylphenyl)-3-(3,5-difluoro-4-methylsulfonylphenyl)-2H-furan-5-one |
|---|---|
| PubChem CID | 18754596 |
| Molecular Formula | C18H13ClF2O4S |
| Molecular Weight | 398.81 g/mol |
| Exact Mass | 398.02 |
| IUPAC Name | 4-(4-chloro-3-methylphenyl)-3-(3,5-difluoro-4-methylsulfonylphenyl)-2H-furan-5-one |
| SMILES | Cc1cc(C2=C(c3cc(F)c(S(C)(=O)=O)c(F)c3)COC2=O)ccc1Cl |
| InChI | InChI=1S/C18H13ClF2O4S/c1-9-5-10(3-4-13(9)19)16-12(8-25-18(16)22)11-6-14(20)17(15(21)7-11)26(2,23)24/h3-7H,8H2,1-2H3 |
| InChIKey | YNNDNKRHZAJHBP-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.81 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|