C18H15F2NO4S — CID 22746313
4-[4-(3,5-dimethylphenyl)-5-oxo-2H-furan-3-yl]-2,6-difluorobenzenesulfonamide (PubChem CID 22746313) has the molecular formula C18H15F2NO4S and a molecular weight of 379.38 g/mol. Its IUPAC name is 4-[4-(3,5-dimethylphenyl)-5-oxo-2H-furan-3-yl]-2,6-difluorobenzenesulfonamide.
| Compound Name | 4-[4-(3,5-dimethylphenyl)-5-oxo-2H-furan-3-yl]-2,6-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 22746313 |
| Molecular Formula | C18H15F2NO4S |
| Molecular Weight | 379.38 g/mol |
| Exact Mass | 379.07 |
| IUPAC Name | 4-[4-(3,5-dimethylphenyl)-5-oxo-2H-furan-3-yl]-2,6-difluorobenzenesulfonamide |
| SMILES | Cc1cc(C)cc(C2=C(c3cc(F)c(S(N)(=O)=O)c(F)c3)COC2=O)c1 |
| InChI | InChI=1S/C18H15F2NO4S/c1-9-3-10(2)5-12(4-9)16-13(8-25-18(16)22)11-6-14(19)17(15(20)7-11)26(21,23)24/h3-7H,8H2,1-2H3,(H2,21,23,24) |
| InChIKey | CIOYSHGPTOKUDR-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.38 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|