C19H19F2NO2S — CID 22747318
4-[2-(3,4-dimethylphenyl)cyclopenten-1-yl]-2,6-difluorobenzenesulfonamide (PubChem CID 22747318) has the molecular formula C19H19F2NO2S and a molecular weight of 363.43 g/mol. Its IUPAC name is 4-[2-(3,4-dimethylphenyl)cyclopenten-1-yl]-2,6-difluorobenzenesulfonamide.
| Compound Name | 4-[2-(3,4-dimethylphenyl)cyclopenten-1-yl]-2,6-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 22747318 |
| Molecular Formula | C19H19F2NO2S |
| Molecular Weight | 363.43 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | 4-[2-(3,4-dimethylphenyl)cyclopenten-1-yl]-2,6-difluorobenzenesulfonamide |
| SMILES | Cc1ccc(C2=C(c3cc(F)c(S(N)(=O)=O)c(F)c3)CCC2)cc1C |
| InChI | InChI=1S/C19H19F2NO2S/c1-11-6-7-13(8-12(11)2)15-4-3-5-16(15)14-9-17(20)19(18(21)10-14)25(22,23)24/h6-10H,3-5H2,1-2H3,(H2,22,23,24) |
| InChIKey | FISGKKVTOGBZET-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.43 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|