C19H13F5O4S — CID 18754853
3-(3,5-difluoro-4-methylsulfonylphenyl)-4-[3-methyl-4-(trifluoromethyl)phenyl]-2H-furan-5-one (PubChem CID 18754853) has the molecular formula C19H13F5O4S and a molecular weight of 432.37 g/mol. Its IUPAC name is 3-(3,5-difluoro-4-methylsulfonylphenyl)-4-[3-methyl-4-(trifluoromethyl)phenyl]-2H-furan-5-one.
| Compound Name | 3-(3,5-difluoro-4-methylsulfonylphenyl)-4-[3-methyl-4-(trifluoromethyl)phenyl]-2H-furan-5-one |
|---|---|
| PubChem CID | 18754853 |
| Molecular Formula | C19H13F5O4S |
| Molecular Weight | 432.37 g/mol |
| Exact Mass | 432.05 |
| IUPAC Name | 3-(3,5-difluoro-4-methylsulfonylphenyl)-4-[3-methyl-4-(trifluoromethyl)phenyl]-2H-furan-5-one |
| SMILES | Cc1cc(C2=C(c3cc(F)c(S(C)(=O)=O)c(F)c3)COC2=O)ccc1C(F)(F)F |
| InChI | InChI=1S/C19H13F5O4S/c1-9-5-10(3-4-13(9)19(22,23)24)16-12(8-28-18(16)25)11-6-14(20)17(15(21)7-11)29(2,26)27/h3-7H,8H2,1-2H3 |
| InChIKey | QGSKMENVUFVAGE-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.37 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|