C17H10F5NO5S — CID 22747367
2,6-difluoro-4-[5-oxo-4-[4-(trifluoromethoxy)phenyl]-2H-furan-3-yl]benzenesulfonamide (PubChem CID 22747367) has the molecular formula C17H10F5NO5S and a molecular weight of 435.33 g/mol. Its IUPAC name is 2,6-difluoro-4-[5-oxo-4-[4-(trifluoromethoxy)phenyl]-2H-furan-3-yl]benzenesulfonamide.
| Compound Name | 2,6-difluoro-4-[5-oxo-4-[4-(trifluoromethoxy)phenyl]-2H-furan-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 22747367 |
| Molecular Formula | C17H10F5NO5S |
| Molecular Weight | 435.33 g/mol |
| Exact Mass | 435.02 |
| IUPAC Name | 2,6-difluoro-4-[5-oxo-4-[4-(trifluoromethoxy)phenyl]-2H-furan-3-yl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1c(F)cc(C2=C(c3ccc(OC(F)(F)F)cc3)C(=O)OC2)cc1F |
| InChI | InChI=1S/C17H10F5NO5S/c18-12-5-9(6-13(19)15(12)29(23,25)26)11-7-27-16(24)14(11)8-1-3-10(4-2-8)28-17(20,21)22/h1-6H,7H2,(H2,23,25,26) |
| InChIKey | ITXBYZMWOMYQOA-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.33 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|