C35H43F2NO — CID 145352127
5-[4-[2-[(4-fluoro-2-methylbutan-2-yl)oxymethyl]pentyl]phenyl]-6-(2-fluoro-4-methylphenyl)-8,9-dihydro-7H-benzo[7]annulen-2-amine (PubChem CID 145352127) has the molecular formula C35H43F2NO and a molecular weight of 531.73 g/mol. Its IUPAC name is 5-[4-[2-[(4-fluoro-2-methylbutan-2-yl)oxymethyl]pentyl]phenyl]-6-(2-fluoro-4-methylphenyl)-8,9-dihydro-7H-benzo[7]annulen-2-amine.
| Compound Name | 5-[4-[2-[(4-fluoro-2-methylbutan-2-yl)oxymethyl]pentyl]phenyl]-6-(2-fluoro-4-methylphenyl)-8,9-dihydro-7H-benzo[7]annulen-2-amine |
|---|---|
| PubChem CID | 145352127 |
| Molecular Formula | C35H43F2NO |
| Molecular Weight | 531.73 g/mol |
| Exact Mass | 531.33 |
| IUPAC Name | 5-[4-[2-[(4-fluoro-2-methylbutan-2-yl)oxymethyl]pentyl]phenyl]-6-(2-fluoro-4-methylphenyl)-8,9-dihydro-7H-benzo[7]annulen-2-amine |
| SMILES | CCCC(COC(C)(C)CCF)Cc1ccc(C2=C(c3ccc(C)cc3F)CCCc3cc(N)ccc32)cc1 |
| InChI | InChI=1S/C35H43F2NO/c1-5-7-26(23-39-35(3,4)18-19-36)21-25-11-13-27(14-12-25)34-30-17-15-29(38)22-28(30)8-6-9-32(34)31-16-10-24(2)20-33(31)37/h10-17,20,22,26H,5-9,18-19,21,23,38H2,1-4H3 |
| InChIKey | JGSAIYQDQJBPQP-UHFFFAOYSA-N |
| XLogP | 9.13 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.73 |
| LogP ≤ 5 | 9.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|