C37H51F2N3 — CID 145352129
4-[2-amino-5-(4-methylphenyl)-8,9-dihydro-7H-benzo[7]annulen-6-yl]-2-fluoro-N'-methylbenzenecarboximidamide;1-fluorobutane;3-methylhexane (PubChem CID 145352129) has the molecular formula C37H51F2N3 and a molecular weight of 575.83 g/mol. Its IUPAC name is 4-[2-amino-5-(4-methylphenyl)-8,9-dihydro-7H-benzo[7]annulen-6-yl]-2-fluoro-N'-methylbenzenecarboximidamide;1-fluorobutane;3-methylhexane.
| Compound Name | 4-[2-amino-5-(4-methylphenyl)-8,9-dihydro-7H-benzo[7]annulen-6-yl]-2-fluoro-N'-methylbenzenecarboximidamide;1-fluorobutane;3-methylhexane |
|---|---|
| PubChem CID | 145352129 |
| Molecular Formula | C37H51F2N3 |
| Molecular Weight | 575.83 g/mol |
| Exact Mass | 575.41 |
| IUPAC Name | 4-[2-amino-5-(4-methylphenyl)-8,9-dihydro-7H-benzo[7]annulen-6-yl]-2-fluoro-N'-methylbenzenecarboximidamide;1-fluorobutane;3-methylhexane |
| SMILES | C/N=C(\N)c1ccc(C2=C(c3ccc(C)cc3)c3ccc(N)cc3CCC2)cc1F.CCCC(C)CC.CCCCF |
| InChI | InChI=1S/C26H26FN3.C7H16.C4H9F/c1-16-6-8-17(9-7-16)25-21(5-3-4-18-14-20(28)11-13-22(18)25)19-10-12-23(24(27)15-19)26(29)30-2;1-4-6-7(3)5-2;1-2-3-4-5/h6-15H,3-5,28H2,1-2H3,(H2,29,30);7H,4-6H2,1-3H3;2-4H2,1H3 |
| InChIKey | PGXYAKWBAOBLTD-UHFFFAOYSA-N |
| XLogP | 9.94 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.83 |
| LogP ≤ 5 | 9.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|