C12H11BrO2 — CID 118423588
6-acetyl-7-bromo-3,4-dihydro-2H-naphthalen-1-one (PubChem CID 118423588) has the molecular formula C12H11BrO2 and a molecular weight of 267.12 g/mol. Its IUPAC name is 6-acetyl-7-bromo-3,4-dihydro-2H-naphthalen-1-one.
| Compound Name | 6-acetyl-7-bromo-3,4-dihydro-2H-naphthalen-1-one |
|---|---|
| PubChem CID | 118423588 |
| Molecular Formula | C12H11BrO2 |
| Molecular Weight | 267.12 g/mol |
| Exact Mass | 265.99 |
| IUPAC Name | 6-acetyl-7-bromo-3,4-dihydro-2H-naphthalen-1-one |
| SMILES | CC(=O)c1cc2c(cc1Br)C(=O)CCC2 |
| InChI | InChI=1S/C12H11BrO2/c1-7(14)9-5-8-3-2-4-12(15)10(8)6-11(9)13/h5-6H,2-4H2,1H3 |
| InChIKey | OZCPMDZEADREBS-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.12 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |