C18H28N2 — CID 65072735
N-(2,3-dihydro-1H-inden-5-yl)-1-propylazepan-4-amine (PubChem CID 65072735) has the molecular formula C18H28N2 and a molecular weight of 272.44 g/mol. Its IUPAC name is N-(2,3-dihydro-1H-inden-5-yl)-1-propylazepan-4-amine.
| Compound Name | N-(2,3-dihydro-1H-inden-5-yl)-1-propylazepan-4-amine |
|---|---|
| PubChem CID | 65072735 |
| Molecular Formula | C18H28N2 |
| Molecular Weight | 272.44 g/mol |
| Exact Mass | 272.23 |
| IUPAC Name | N-(2,3-dihydro-1H-inden-5-yl)-1-propylazepan-4-amine |
| SMILES | CCCN1CCCC(Nc2ccc3c(c2)CCC3)CC1 |
| InChI | InChI=1S/C18H28N2/c1-2-11-20-12-4-7-17(10-13-20)19-18-9-8-15-5-3-6-16(15)14-18/h8-9,14,17,19H,2-7,10-13H2,1H3 |
| InChIKey | UAXZNAUVZCNPDQ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.44 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |