C16H25ClN2 — CID 63451177
2-chloro-4-N-(2,6-dimethylcyclohexyl)-1-N,1-N-dimethylbenzene-1,4-diamine (PubChem CID 63451177) has the molecular formula C16H25ClN2 and a molecular weight of 280.84 g/mol. Its IUPAC name is 2-chloro-4-N-(2,6-dimethylcyclohexyl)-1-N,1-N-dimethylbenzene-1,4-diamine.
| Compound Name | 2-chloro-4-N-(2,6-dimethylcyclohexyl)-1-N,1-N-dimethylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 63451177 |
| Molecular Formula | C16H25ClN2 |
| Molecular Weight | 280.84 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | 2-chloro-4-N-(2,6-dimethylcyclohexyl)-1-N,1-N-dimethylbenzene-1,4-diamine |
| SMILES | CC1CCCC(C)C1Nc1ccc(N(C)C)c(Cl)c1 |
| InChI | InChI=1S/C16H25ClN2/c1-11-6-5-7-12(2)16(11)18-13-8-9-15(19(3)4)14(17)10-13/h8-12,16,18H,5-7H2,1-4H3 |
| InChIKey | ZXTKWOCQAUCKAR-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.84 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|