C18H29ClN2 — CID 63451308
2-chloro-1-N,1-N-dimethyl-4-N-(5-methyl-2-propan-2-ylcyclohexyl)benzene-1,4-diamine (PubChem CID 63451308) has the molecular formula C18H29ClN2 and a molecular weight of 308.90 g/mol. Its IUPAC name is 2-chloro-1-N,1-N-dimethyl-4-N-(5-methyl-2-propan-2-ylcyclohexyl)benzene-1,4-diamine.
| Compound Name | 2-chloro-1-N,1-N-dimethyl-4-N-(5-methyl-2-propan-2-ylcyclohexyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 63451308 |
| Molecular Formula | C18H29ClN2 |
| Molecular Weight | 308.90 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | 2-chloro-1-N,1-N-dimethyl-4-N-(5-methyl-2-propan-2-ylcyclohexyl)benzene-1,4-diamine |
| SMILES | CC1CCC(C(C)C)C(Nc2ccc(N(C)C)c(Cl)c2)C1 |
| InChI | InChI=1S/C18H29ClN2/c1-12(2)15-8-6-13(3)10-17(15)20-14-7-9-18(21(4)5)16(19)11-14/h7,9,11-13,15,17,20H,6,8,10H2,1-5H3 |
| InChIKey | NBBJYQREWVPABK-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.90 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|