C13H17NO2 — CID 114988661
2-(2,3-dihydro-1H-inden-5-ylamino)-2-methylpropanoic acid (PubChem CID 114988661) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is 2-(2,3-dihydro-1H-inden-5-ylamino)-2-methylpropanoic acid.
| Compound Name | 2-(2,3-dihydro-1H-inden-5-ylamino)-2-methylpropanoic acid |
|---|---|
| PubChem CID | 114988661 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | 2-(2,3-dihydro-1H-inden-5-ylamino)-2-methylpropanoic acid |
| SMILES | CC(C)(Nc1ccc2c(c1)CCC2)C(=O)O |
| InChI | InChI=1S/C13H17NO2/c1-13(2,12(15)16)14-11-7-6-9-4-3-5-10(9)8-11/h6-8,14H,3-5H2,1-2H3,(H,15,16) |
| InChIKey | LRJHLZSQEYAUPO-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |