C17H21NO5S — CID 146476186
4-[[3-[(3-amino-2-hydroxypropoxy)methyl]phenyl]methyl]benzenesulfonic acid (PubChem CID 146476186) has the molecular formula C17H21NO5S and a molecular weight of 351.42 g/mol. Its IUPAC name is 4-[[3-[(3-amino-2-hydroxypropoxy)methyl]phenyl]methyl]benzenesulfonic acid.
| Compound Name | 4-[[3-[(3-amino-2-hydroxypropoxy)methyl]phenyl]methyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 146476186 |
| Molecular Formula | C17H21NO5S |
| Molecular Weight | 351.42 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | 4-[[3-[(3-amino-2-hydroxypropoxy)methyl]phenyl]methyl]benzenesulfonic acid |
| SMILES | NCC(O)COCc1cccc(Cc2ccc(S(=O)(=O)O)cc2)c1 |
| InChI | InChI=1S/C17H21NO5S/c18-10-16(19)12-23-11-15-3-1-2-14(9-15)8-13-4-6-17(7-5-13)24(20,21)22/h1-7,9,16,19H,8,10-12,18H2,(H,20,21,22) |
| InChIKey | OHMVZUALFXACIB-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.42 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|