C10H13NO5 — CID 56629531
3-[(3-nitrophenyl)methoxy]propane-1,2-diol (PubChem CID 56629531) has the molecular formula C10H13NO5 and a molecular weight of 227.22 g/mol. Its IUPAC name is 3-[(3-nitrophenyl)methoxy]propane-1,2-diol.
| Compound Name | 3-[(3-nitrophenyl)methoxy]propane-1,2-diol |
|---|---|
| PubChem CID | 56629531 |
| Molecular Formula | C10H13NO5 |
| Molecular Weight | 227.22 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | 3-[(3-nitrophenyl)methoxy]propane-1,2-diol |
| SMILES | O=[N+]([O-])c1cccc(COCC(O)CO)c1 |
| InChI | InChI=1S/C10H13NO5/c12-5-10(13)7-16-6-8-2-1-3-9(4-8)11(14)15/h1-4,10,12-13H,5-7H2 |
| InChIKey | MWLXKWYTXJLQOU-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 92.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.22 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|