C12H21NO7S — CID 139486922
methylsulfinylmethane;(3-nitrophenyl)methanol;propane-1,2,3-triol (PubChem CID 139486922) has the molecular formula C12H21NO7S and a molecular weight of 323.37 g/mol. Its IUPAC name is methylsulfinylmethane;(3-nitrophenyl)methanol;propane-1,2,3-triol.
| Compound Name | methylsulfinylmethane;(3-nitrophenyl)methanol;propane-1,2,3-triol |
|---|---|
| PubChem CID | 139486922 |
| Molecular Formula | C12H21NO7S |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | methylsulfinylmethane;(3-nitrophenyl)methanol;propane-1,2,3-triol |
| SMILES | CS(C)=O.O=[N+]([O-])c1cccc(CO)c1.OCC(O)CO |
| InChI | InChI=1S/C7H7NO3.C3H8O3.C2H6OS/c9-5-6-2-1-3-7(4-6)8(10)11;4-1-3(6)2-5;1-4(2)3/h1-4,9H,5H2;3-6H,1-2H2;1-2H3 |
| InChIKey | YBKWDRKARNTHMC-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 141.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|