C10H16NOP — CID 58738332
N-[(3,4-dimethylphenyl)methoxy]-1-phosphanylmethanamine (PubChem CID 58738332) has the molecular formula C10H16NOP and a molecular weight of 197.22 g/mol. Its IUPAC name is N-[(3,4-dimethylphenyl)methoxy]-1-phosphanylmethanamine.
| Compound Name | N-[(3,4-dimethylphenyl)methoxy]-1-phosphanylmethanamine |
|---|---|
| PubChem CID | 58738332 |
| Molecular Formula | C10H16NOP |
| Molecular Weight | 197.22 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | N-[(3,4-dimethylphenyl)methoxy]-1-phosphanylmethanamine |
| SMILES | Cc1ccc(CONCP)cc1C |
| InChI | InChI=1S/C10H16NOP/c1-8-3-4-10(5-9(8)2)6-12-11-7-13/h3-5,11H,6-7,13H2,1-2H3 |
| InChIKey | FCVBTWZXWPYKMS-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.22 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|