C14H20BrNO2 — CID 115194169
N-[2-(4-methoxy-2,3,6-trimethylphenyl)ethyl]-N-methylcarbamoyl bromide (PubChem CID 115194169) has the molecular formula C14H20BrNO2 and a molecular weight of 314.22 g/mol. Its IUPAC name is N-[2-(4-methoxy-2,3,6-trimethylphenyl)ethyl]-N-methylcarbamoyl bromide.
| Compound Name | N-[2-(4-methoxy-2,3,6-trimethylphenyl)ethyl]-N-methylcarbamoyl bromide |
|---|---|
| PubChem CID | 115194169 |
| Molecular Formula | C14H20BrNO2 |
| Molecular Weight | 314.22 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | N-[2-(4-methoxy-2,3,6-trimethylphenyl)ethyl]-N-methylcarbamoyl bromide |
| SMILES | COc1cc(C)c(CCN(C)C(=O)Br)c(C)c1C |
| InChI | InChI=1S/C14H20BrNO2/c1-9-8-13(18-5)11(3)10(2)12(9)6-7-16(4)14(15)17/h8H,6-7H2,1-5H3 |
| InChIKey | VQLWKFUSADJTGJ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.22 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|