C19H23Cl2NO3S2 — CID 3829648
N-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]-4-methoxy-2,3,6-trimethylbenzenesulfonamide (PubChem CID 3829648) has the molecular formula C19H23Cl2NO3S2 and a molecular weight of 448.44 g/mol. Its IUPAC name is N-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]-4-methoxy-2,3,6-trimethylbenzenesulfonamide.
| Compound Name | N-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]-4-methoxy-2,3,6-trimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 3829648 |
| Molecular Formula | C19H23Cl2NO3S2 |
| Molecular Weight | 448.44 g/mol |
| Exact Mass | 447.05 |
| IUPAC Name | N-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]-4-methoxy-2,3,6-trimethylbenzenesulfonamide |
| SMILES | COc1cc(C)c(S(=O)(=O)NCCSCc2c(Cl)cccc2Cl)c(C)c1C |
| InChI | InChI=1S/C19H23Cl2NO3S2/c1-12-10-18(25-4)13(2)14(3)19(12)27(23,24)22-8-9-26-11-15-16(20)6-5-7-17(15)21/h5-7,10,22H,8-9,11H2,1-4H3 |
| InChIKey | IVCIJMBOUMTGSC-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.44 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|