C16H17ClINO3S2 — CID 3981315
N-[2-[(2-chlorophenyl)methylsulfanyl]ethyl]-3-iodo-4-methoxybenzenesulfonamide (PubChem CID 3981315) has the molecular formula C16H17ClINO3S2 and a molecular weight of 497.81 g/mol. Its IUPAC name is N-[2-[(2-chlorophenyl)methylsulfanyl]ethyl]-3-iodo-4-methoxybenzenesulfonamide.
| Compound Name | N-[2-[(2-chlorophenyl)methylsulfanyl]ethyl]-3-iodo-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 3981315 |
| Molecular Formula | C16H17ClINO3S2 |
| Molecular Weight | 497.81 g/mol |
| Exact Mass | 496.94 |
| IUPAC Name | N-[2-[(2-chlorophenyl)methylsulfanyl]ethyl]-3-iodo-4-methoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NCCSCc2ccccc2Cl)cc1I |
| InChI | InChI=1S/C16H17ClINO3S2/c1-22-16-7-6-13(10-15(16)18)24(20,21)19-8-9-23-11-12-4-2-3-5-14(12)17/h2-7,10,19H,8-9,11H2,1H3 |
| InChIKey | HUQIRAFIHMRBPQ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.81 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|