C16H14ClFN2O2S2 — CID 8813776
3-chloro-N-[2-[(2-cyanophenyl)methylsulfanyl]ethyl]-4-fluorobenzenesulfonamide (PubChem CID 8813776) has the molecular formula C16H14ClFN2O2S2 and a molecular weight of 384.89 g/mol. Its IUPAC name is 3-chloro-N-[2-[(2-cyanophenyl)methylsulfanyl]ethyl]-4-fluorobenzenesulfonamide.
| Compound Name | 3-chloro-N-[2-[(2-cyanophenyl)methylsulfanyl]ethyl]-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 8813776 |
| Molecular Formula | C16H14ClFN2O2S2 |
| Molecular Weight | 384.89 g/mol |
| Exact Mass | 384.02 |
| IUPAC Name | 3-chloro-N-[2-[(2-cyanophenyl)methylsulfanyl]ethyl]-4-fluorobenzenesulfonamide |
| SMILES | N#Cc1ccccc1CSCCNS(=O)(=O)c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C16H14ClFN2O2S2/c17-15-9-14(5-6-16(15)18)24(21,22)20-7-8-23-11-13-4-2-1-3-12(13)10-19/h1-6,9,20H,7-8,11H2 |
| InChIKey | WIYRBJWMUUKODQ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.89 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|