C19H18ClNO2S2 — CID 3886966
N-[2-[(4-chlorophenyl)methylsulfanyl]ethyl]naphthalene-2-sulfonamide (PubChem CID 3886966) has the molecular formula C19H18ClNO2S2 and a molecular weight of 391.95 g/mol. Its IUPAC name is N-[2-[(4-chlorophenyl)methylsulfanyl]ethyl]naphthalene-2-sulfonamide.
| Compound Name | N-[2-[(4-chlorophenyl)methylsulfanyl]ethyl]naphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 3886966 |
| Molecular Formula | C19H18ClNO2S2 |
| Molecular Weight | 391.95 g/mol |
| Exact Mass | 391.05 |
| IUPAC Name | N-[2-[(4-chlorophenyl)methylsulfanyl]ethyl]naphthalene-2-sulfonamide |
| SMILES | O=S(=O)(NCCSCc1ccc(Cl)cc1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C19H18ClNO2S2/c20-18-8-5-15(6-9-18)14-24-12-11-21-25(22,23)19-10-7-16-3-1-2-4-17(16)13-19/h1-10,13,21H,11-12,14H2 |
| InChIKey | ZDXRAWSBEAEKPG-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.95 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|