C17H18NNaO5S2 — CID 23671202
sodium 2-[4-[2-(benzenesulfonamido)ethylsulfanylmethyl]phenoxy]acetate (PubChem CID 23671202) has the molecular formula C17H18NNaO5S2 and a molecular weight of 403.46 g/mol. Its IUPAC name is sodium 2-[4-[2-(benzenesulfonamido)ethylsulfanylmethyl]phenoxy]acetate.
| Compound Name | sodium 2-[4-[2-(benzenesulfonamido)ethylsulfanylmethyl]phenoxy]acetate |
|---|---|
| PubChem CID | 23671202 |
| Molecular Formula | C17H18NNaO5S2 |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.05 |
| IUPAC Name | sodium 2-[4-[2-(benzenesulfonamido)ethylsulfanylmethyl]phenoxy]acetate |
| SMILES | O=C([O-])COc1ccc(CSCCNS(=O)(=O)c2ccccc2)cc1.[Na+] |
| InChI | InChI=1S/C17H19NO5S2.Na/c19-17(20)12-23-15-8-6-14(7-9-15)13-24-11-10-18-25(21,22)16-4-2-1-3-5-16;/h1-9,18H,10-13H2,(H,19,20);/q;+1/p-1 |
| InChIKey | FSPGPPDGKAFVES-UHFFFAOYSA-M |
| XLogP | -1.97 |
| TPSA | 95.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | -1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|