C19H22NNaO5S2 — CID 23671207
sodium 2-[4-[2-[1-(benzenesulfonamido)propylsulfanyl]ethyl]phenoxy]acetate (PubChem CID 23671207) has the molecular formula C19H22NNaO5S2 and a molecular weight of 431.51 g/mol. Its IUPAC name is sodium 2-[4-[2-[1-(benzenesulfonamido)propylsulfanyl]ethyl]phenoxy]acetate.
| Compound Name | sodium 2-[4-[2-[1-(benzenesulfonamido)propylsulfanyl]ethyl]phenoxy]acetate |
|---|---|
| PubChem CID | 23671207 |
| Molecular Formula | C19H22NNaO5S2 |
| Molecular Weight | 431.51 g/mol |
| Exact Mass | 431.08 |
| IUPAC Name | sodium 2-[4-[2-[1-(benzenesulfonamido)propylsulfanyl]ethyl]phenoxy]acetate |
| SMILES | CCC(NS(=O)(=O)c1ccccc1)SCCc1ccc(OCC(=O)[O-])cc1.[Na+] |
| InChI | InChI=1S/C19H23NO5S2.Na/c1-2-18(20-27(23,24)17-6-4-3-5-7-17)26-13-12-15-8-10-16(11-9-15)25-14-19(21)22;/h3-11,18,20H,2,12-14H2,1H3,(H,21,22);/q;+1/p-1 |
| InChIKey | UKFVCJUTPIKCRP-UHFFFAOYSA-M |
| XLogP | -1.19 |
| TPSA | 95.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.51 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|