C19H17Cl2NO2S2 — CID 3513225
N-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]naphthalene-1-sulfonamide (PubChem CID 3513225) has the molecular formula C19H17Cl2NO2S2 and a molecular weight of 426.39 g/mol. Its IUPAC name is N-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]naphthalene-1-sulfonamide.
| Compound Name | N-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]naphthalene-1-sulfonamide |
|---|---|
| PubChem CID | 3513225 |
| Molecular Formula | C19H17Cl2NO2S2 |
| Molecular Weight | 426.39 g/mol |
| Exact Mass | 425.01 |
| IUPAC Name | N-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]naphthalene-1-sulfonamide |
| SMILES | O=S(=O)(NCCSCc1c(Cl)cccc1Cl)c1cccc2ccccc12 |
| InChI | InChI=1S/C19H17Cl2NO2S2/c20-17-8-4-9-18(21)16(17)13-25-12-11-22-26(23,24)19-10-3-6-14-5-1-2-7-15(14)19/h1-10,22H,11-13H2 |
| InChIKey | KNNFEURNCFPZDU-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.39 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|