C17H17Cl2NO3S2 — CID 3754145
4-acetyl-N-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]benzenesulfonamide (PubChem CID 3754145) has the molecular formula C17H17Cl2NO3S2 and a molecular weight of 418.37 g/mol. Its IUPAC name is 4-acetyl-N-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]benzenesulfonamide.
| Compound Name | 4-acetyl-N-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 3754145 |
| Molecular Formula | C17H17Cl2NO3S2 |
| Molecular Weight | 418.37 g/mol |
| Exact Mass | 417.00 |
| IUPAC Name | 4-acetyl-N-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]benzenesulfonamide |
| SMILES | CC(=O)c1ccc(S(=O)(=O)NCCSCc2c(Cl)cccc2Cl)cc1 |
| InChI | InChI=1S/C17H17Cl2NO3S2/c1-12(21)13-5-7-14(8-6-13)25(22,23)20-9-10-24-11-15-16(18)3-2-4-17(15)19/h2-8,20H,9-11H2,1H3 |
| InChIKey | ZOICUJNVRZGIEW-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.37 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|