C31H36N4O6S — CID 172641436
9H-fluoren-9-ylmethyl N-[5-[[amino-[(4-methoxy-2,3,6-trimethylphenyl)sulfonylamino]methylidene]amino]-1-oxopentan-2-yl]carbamate (PubChem CID 172641436) has the molecular formula C31H36N4O6S and a molecular weight of 592.72 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[5-[[amino-[(4-methoxy-2,3,6-trimethylphenyl)sulfonylamino]methylidene]amino]-1-oxopentan-2-yl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[5-[[amino-[(4-methoxy-2,3,6-trimethylphenyl)sulfonylamino]methylidene]amino]-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 172641436 |
| Molecular Formula | C31H36N4O6S |
| Molecular Weight | 592.72 g/mol |
| Exact Mass | 592.24 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[5-[[amino-[(4-methoxy-2,3,6-trimethylphenyl)sulfonylamino]methylidene]amino]-1-oxopentan-2-yl]carbamate |
| SMILES | COc1cc(C)c(S(=O)(=O)N/C(N)=N/CCCC(C=O)NC(=O)OCC2c3ccccc3-c3ccccc32)c(C)c1C |
| InChI | InChI=1S/C31H36N4O6S/c1-19-16-28(40-4)20(2)21(3)29(19)42(38,39)35-30(32)33-15-9-10-22(17-36)34-31(37)41-18-27-25-13-7-5-11-23(25)24-12-6-8-14-26(24)27/h5-8,11-14,16-17,22,27H,9-10,15,18H2,1-4H3,(H,34,37)(H3,32,33,35) |
| InChIKey | LHHUQFSCYXKMJG-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 149.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.72 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|