C34H41N5O8S — CID 153428364
(2S)-2-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]amino]-5-[[(E)-N'-[(4-methoxy-2,3,6-trimethylphenyl)sulfonylmethyl]carbamimidoyl]amino]pentanoic acid (PubChem CID 153428364) has the molecular formula C34H41N5O8S and a molecular weight of 679.80 g/mol. Its IUPAC name is (2S)-2-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]amino]-5-[[(E)-N'-[(4-methoxy-2,3,6-trimethylphenyl)sulfonylmethyl]carbamimidoyl]amino]pentanoic acid.
| Compound Name | (2S)-2-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]amino]-5-[[(E)-N'-[(4-methoxy-2,3,6-trimethylphenyl)sulfonylmethyl]carbamimidoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 153428364 |
| Molecular Formula | C34H41N5O8S |
| Molecular Weight | 679.80 g/mol |
| Exact Mass | 679.27 |
| IUPAC Name | (2S)-2-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]amino]-5-[[(E)-N'-[(4-methoxy-2,3,6-trimethylphenyl)sulfonylmethyl]carbamimidoyl]amino]pentanoic acid |
| SMILES | COc1cc(C)c(S(=O)(=O)C/N=C(\N)NCCC[C@H](NC(=O)CNC(=O)OCC2c3ccccc3-c3ccccc32)C(=O)O)c(C)c1C |
| InChI | InChI=1S/C34H41N5O8S/c1-20-16-29(46-4)21(2)22(3)31(20)48(44,45)19-38-33(35)36-15-9-14-28(32(41)42)39-30(40)17-37-34(43)47-18-27-25-12-7-5-10-23(25)24-11-6-8-13-26(24)27/h5-8,10-13,16,27-28H,9,14-15,17-19H2,1-4H3,(H,37,43)(H,39,40)(H,41,42)(H3,35,36,38)/t28-/m0/s1 |
| InChIKey | KQVOSXXHVGROMT-NDEPHWFRSA-N |
| XLogP | 3.14 |
| TPSA | 198.51 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.80 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|